C14H13FN2O3 — CID 116813065
6-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pyridin-2-amine (PubChem CID 116813065) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is 6-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 116813065 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 6-fluoro-N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]pyridin-2-amine |
| SMILES | COc1cc(CNc2cccc(F)n2)cc2c1OCO2 |
| InChI | InChI=1S/C14H13FN2O3/c1-18-10-5-9(6-11-14(10)20-8-19-11)7-16-13-4-2-3-12(15)17-13/h2-6H,7-8H2,1H3,(H,16,17) |
| InChIKey | OULQDFUGKRNUOI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|