C16H15N3O3 — CID 23734124
N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indazol-5-amine (PubChem CID 23734124) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indazol-5-amine.
| Compound Name | N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 23734124 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indazol-5-amine |
| SMILES | COc1cc(CNc2ccc3[nH]ncc3c2)cc2c1OCO2 |
| InChI | InChI=1S/C16H15N3O3/c1-20-14-4-10(5-15-16(14)22-9-21-15)7-17-12-2-3-13-11(6-12)8-18-19-13/h2-6,8,17H,7,9H2,1H3,(H,18,19) |
| InChIKey | XHMCDMGVMCZGNC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |