C19H25ClN2O2S — CID 60580699
1-[(5-chlorothiophen-2-yl)methyl]-1-ethyl-3-[[3-(2-methylpropoxy)phenyl]methyl]urea (PubChem CID 60580699) has the molecular formula C19H25ClN2O2S and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-1-ethyl-3-[[3-(2-methylpropoxy)phenyl]methyl]urea.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-1-ethyl-3-[[3-(2-methylpropoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 60580699 |
| Molecular Formula | C19H25ClN2O2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-1-ethyl-3-[[3-(2-methylpropoxy)phenyl]methyl]urea |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)NCc1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C19H25ClN2O2S/c1-4-22(12-17-8-9-18(20)25-17)19(23)21-11-15-6-5-7-16(10-15)24-13-14(2)3/h5-10,14H,4,11-13H2,1-3H3,(H,21,23) |
| InChIKey | XTOKTJJBKCHZMX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |