C20H26N2O2S — CID 60580734
3-[[3-(2-methylpropoxy)phenyl]methyl]-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea (PubChem CID 60580734) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 3-[[3-(2-methylpropoxy)phenyl]methyl]-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[[3-(2-methylpropoxy)phenyl]methyl]-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60580734 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-[[3-(2-methylpropoxy)phenyl]methyl]-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea |
| SMILES | C=CCN(Cc1cccs1)C(=O)NCc1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C20H26N2O2S/c1-4-10-22(14-19-9-6-11-25-19)20(23)21-13-17-7-5-8-18(12-17)24-15-16(2)3/h4-9,11-12,16H,1,10,13-15H2,2-3H3,(H,21,23) |
| InChIKey | MEGKPBQXNCFANW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|