C18H19ClN2OS — CID 60580727
3-(5-chloro-2,3-dihydro-1H-inden-1-yl)-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea (PubChem CID 60580727) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is 3-(5-chloro-2,3-dihydro-1H-inden-1-yl)-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-(5-chloro-2,3-dihydro-1H-inden-1-yl)-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60580727 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-(5-chloro-2,3-dihydro-1H-inden-1-yl)-1-prop-2-enyl-1-(thiophen-2-ylmethyl)urea |
| SMILES | C=CCN(Cc1cccs1)C(=O)NC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H19ClN2OS/c1-2-9-21(12-15-4-3-10-23-15)18(22)20-17-8-5-13-11-14(19)6-7-16(13)17/h2-4,6-7,10-11,17H,1,5,8-9,12H2,(H,20,22) |
| InChIKey | OCMQLSVKDHATIC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|