C18H27N3O2S — CID 60547622
N-cyclohexyl-3-[[prop-2-enyl(thiophen-2-ylmethyl)carbamoyl]amino]propanamide (PubChem CID 60547622) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-cyclohexyl-3-[[prop-2-enyl(thiophen-2-ylmethyl)carbamoyl]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[prop-2-enyl(thiophen-2-ylmethyl)carbamoyl]amino]propanamide |
|---|---|
| PubChem CID | 60547622 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-cyclohexyl-3-[[prop-2-enyl(thiophen-2-ylmethyl)carbamoyl]amino]propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)NCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H27N3O2S/c1-2-12-21(14-16-9-6-13-24-16)18(23)19-11-10-17(22)20-15-7-4-3-5-8-15/h2,6,9,13,15H,1,3-5,7-8,10-12,14H2,(H,19,23)(H,20,22) |
| InChIKey | OBQARYWCJGCAPN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|