C21H31ClN2O2S — CID 86810128
1-[(2-chloroacetyl)-(thiophen-2-ylmethyl)amino]-N-cycloheptylcyclohexane-1-carboxamide (PubChem CID 86810128) has the molecular formula C21H31ClN2O2S and a molecular weight of 411.01 g/mol. Its IUPAC name is 1-[(2-chloroacetyl)-(thiophen-2-ylmethyl)amino]-N-cycloheptylcyclohexane-1-carboxamide.
| Compound Name | 1-[(2-chloroacetyl)-(thiophen-2-ylmethyl)amino]-N-cycloheptylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86810128 |
| Molecular Formula | C21H31ClN2O2S |
| Molecular Weight | 411.01 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[(2-chloroacetyl)-(thiophen-2-ylmethyl)amino]-N-cycloheptylcyclohexane-1-carboxamide |
| SMILES | O=C(CCl)N(Cc1cccs1)C1(C(=O)NC2CCCCCC2)CCCCC1 |
| InChI | InChI=1S/C21H31ClN2O2S/c22-15-19(25)24(16-18-11-8-14-27-18)21(12-6-3-7-13-21)20(26)23-17-9-4-1-2-5-10-17/h8,11,14,17H,1-7,9-10,12-13,15-16H2,(H,23,26) |
| InChIKey | CRICVPLCQCZAJS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|