C21H25BrN2O4S — CID 60581363
(2-bromo-3-pyridinyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 60581363) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-bromo-3-pyridinyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 60581363 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (2-bromo-3-pyridinyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)Oc3cccnc3Br)CC2)c1C |
| InChI | InChI=1S/C21H25BrN2O4S/c1-13-12-14(2)16(4)19(15(13)3)29(26,27)24-10-7-17(8-11-24)21(25)28-18-6-5-9-23-20(18)22/h5-6,9,12,17H,7-8,10-11H2,1-4H3 |
| InChIKey | KOXWAFMNDIWBCK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|