C24H31NO5S2 — CID 42985326
(4-oxo-4-thiophen-2-ylbutyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 42985326) has the molecular formula C24H31NO5S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 42985326 |
| Molecular Formula | C24H31NO5S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 1-(2,3,5,6-tetramethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCC(C(=O)OCCCC(=O)c3cccs3)CC2)c1C |
| InChI | InChI=1S/C24H31NO5S2/c1-16-15-17(2)19(4)23(18(16)3)32(28,29)25-11-9-20(10-12-25)24(27)30-13-5-7-21(26)22-8-6-14-31-22/h6,8,14-15,20H,5,7,9-13H2,1-4H3 |
| InChIKey | RVNCSKMPQGDCGG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|