C25H27N3O3 — CID 60587775
3-[[2-[2-(2,6-dimethylphenoxy)anilino]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 60587775) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[[2-[2-(2,6-dimethylphenoxy)anilino]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[2-(2,6-dimethylphenoxy)anilino]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 60587775 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[[2-[2-(2,6-dimethylphenoxy)anilino]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1Oc1ccccc1NCC(=O)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-17-9-7-10-18(2)24(17)31-22-14-6-5-13-21(22)26-16-23(29)27-20-12-8-11-19(15-20)25(30)28(3)4/h5-15,26H,16H2,1-4H3,(H,27,29) |
| InChIKey | HCDAGXAQDPDDLR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |