C21H24N4O3 — CID 32991361
2-[[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-prop-2-enylbenzamide (PubChem CID 32991361) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 32991361 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[[2-[3-(dimethylcarbamoyl)anilino]-2-oxoethyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NCC(=O)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-4-12-22-20(27)17-10-5-6-11-18(17)23-14-19(26)24-16-9-7-8-15(13-16)21(28)25(2)3/h4-11,13,23H,1,12,14H2,2-3H3,(H,22,27)(H,24,26) |
| InChIKey | OSBDDKWTNRIJOB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|