C25H31N3O4 — CID 60590623
N-[1-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide (PubChem CID 60590623) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[1-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[1-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 60590623 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[1-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(C(=O)NCc2ccc3[nH]c(C)c(C)c3c2)C(C)C)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-14(2)23(28-24(29)18-10-19(31-5)12-20(11-18)32-6)25(30)26-13-17-7-8-22-21(9-17)15(3)16(4)27-22/h7-12,14,23,27H,13H2,1-6H3,(H,26,30)(H,28,29) |
| InChIKey | AXVNTEJVUYLFLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|