C21H19F3N4O3 — CID 60595469
N-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methyl-5-nitrobenzamide (PubChem CID 60595469) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methyl-5-nitrobenzamide.
| Compound Name | N-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 60595469 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methyl-5-nitrobenzamide |
| SMILES | Cc1cc(C)n(-c2ccc(CNC(=O)c3cc([N+](=O)[O-])ccc3C)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H19F3N4O3/c1-12-4-6-17(28(30)31)9-18(12)20(29)25-11-15-5-7-16(10-19(15)21(22,23)24)27-14(3)8-13(2)26-27/h4-10H,11H2,1-3H3,(H,25,29) |
| InChIKey | LGMBOMLWEXILHE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|