C15H18F3N5 — CID 110918505
1-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 110918505) has the molecular formula C15H18F3N5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 1-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110918505 |
| Molecular Formula | C15H18F3N5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1ccc(-n2nc(C)cc2C)cc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3N5/c1-9-6-10(2)23(22-9)12-5-4-11(8-21-14(19)20-3)13(7-12)15(16,17)18/h4-7H,8H2,1-3H3,(H3,19,20,21) |
| InChIKey | JVBXPUBQUJNHRY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|