C19H25F3IN5 — CID 111083856
1-(cyclobutylmethyl)-2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111083856) has the molecular formula C19H25F3IN5 and a molecular weight of 507.34 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083856 |
| Molecular Formula | C19H25F3IN5 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)n(-c2ccc(C/N=C(\N)NCC3CCC3)c(C(F)(F)F)c2)n1.I |
| InChI | InChI=1S/C19H24F3N5.HI/c1-12-8-13(2)27(26-12)16-7-6-15(17(9-16)19(20,21)22)11-25-18(23)24-10-14-4-3-5-14;/h6-9,14H,3-5,10-11H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | BRIGIHVVRVFFSO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|