C22H26F3IN6 — CID 110968305
2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110968305) has the molecular formula C22H26F3IN6 and a molecular weight of 558.39 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110968305 |
| Molecular Formula | C22H26F3IN6 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-[[4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)phenyl]methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2nc(C)cc2C)cc1C(F)(F)F)NCc1ccccn1.I |
| InChI | InChI=1S/C22H25F3N6.HI/c1-4-26-21(29-14-18-7-5-6-10-27-18)28-13-17-8-9-19(12-20(17)22(23,24)25)31-16(3)11-15(2)30-31;/h5-12H,4,13-14H2,1-3H3,(H2,26,28,29);1H |
| InChIKey | KBGRHOJZZPEBRB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|