C19H15ClN4O5 — CID 9090939
1-(4-chlorophenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-6-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 9090939) has the molecular formula C19H15ClN4O5 and a molecular weight of 414.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-6-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-6-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9090939 |
| Molecular Formula | C19H15ClN4O5 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-6-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCc2cc([N+](=O)[O-])ccc2O)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN4O5/c1-11-8-17(26)18(22-23(11)14-4-2-13(20)3-5-14)19(27)21-10-12-9-15(24(28)29)6-7-16(12)25/h2-9,25H,10H2,1H3,(H,21,27) |
| InChIKey | FDUBRJOWYVLAPT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|