C20H24N2O4 — CID 60595823
benzyl N-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]carbamate (PubChem CID 60595823) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzyl N-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 60595823 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzyl N-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-20(2,3)15-9-10-17(23)16(11-15)22-18(24)12-21-19(25)26-13-14-7-5-4-6-8-14/h4-11,23H,12-13H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | JYPDKNAWCQLHGJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|