C25H36N2O4Si — CID 149150728
benzyl N-[2-oxo-2-[2-(4,5,5-trimethyl-4-silyloxyhexan-2-yl)anilino]ethyl]carbamate (PubChem CID 149150728) has the molecular formula C25H36N2O4Si and a molecular weight of 456.66 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[2-(4,5,5-trimethyl-4-silyloxyhexan-2-yl)anilino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[2-(4,5,5-trimethyl-4-silyloxyhexan-2-yl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 149150728 |
| Molecular Formula | C25H36N2O4Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | benzyl N-[2-oxo-2-[2-(4,5,5-trimethyl-4-silyloxyhexan-2-yl)anilino]ethyl]carbamate |
| SMILES | CC(CC(C)(O[SiH3])C(C)(C)C)c1ccccc1NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H36N2O4Si/c1-18(15-25(5,31-32)24(2,3)4)20-13-9-10-14-21(20)27-22(28)16-26-23(29)30-17-19-11-7-6-8-12-19/h6-14,18H,15-17H2,1-5,32H3,(H,26,29)(H,27,28) |
| InChIKey | CQSIIRDTAVDWBP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|