C25H35N2O4Si — CID 70269487
CID 70269487 (PubChem CID 70269487) has the molecular formula C25H35N2O4Si and a molecular weight of 455.65 g/mol.
| Compound Name | CID 70269487 |
|---|---|
| PubChem CID | 70269487 |
| Molecular Formula | C25H35N2O4Si |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(CCC(C)(C)C)c1ccccc1NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35N2O4Si/c1-25(2,3)16-15-22(31-32(4)5)20-13-9-10-14-21(20)27-23(28)17-26-24(29)30-18-19-11-7-6-8-12-19/h6-14,22H,15-18H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | VISGZDLICAFKLP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|