C14H7Cl4N3O — CID 60599154
3,4,5,6-tetrachloro-N-[4-(cyanomethyl)phenyl]pyridine-2-carboxamide (PubChem CID 60599154) has the molecular formula C14H7Cl4N3O and a molecular weight of 375.04 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-[4-(cyanomethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-[4-(cyanomethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60599154 |
| Molecular Formula | C14H7Cl4N3O |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-[4-(cyanomethyl)phenyl]pyridine-2-carboxamide |
| SMILES | N#CCc1ccc(NC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C14H7Cl4N3O/c15-9-10(16)12(21-13(18)11(9)17)14(22)20-8-3-1-7(2-4-8)5-6-19/h1-4H,5H2,(H,20,22) |
| InChIKey | GVVURTVVSKMWBN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|