C19H19N3O3 — CID 60603738
1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1H-indol-2-ylmethyl)urea (PubChem CID 60603738) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1H-indol-2-ylmethyl)urea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1H-indol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60603738 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(1H-indol-2-ylmethyl)urea |
| SMILES | CC(NC(=O)NCc1cc2ccccc2[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N3O3/c1-12(13-6-7-17-18(9-13)25-11-24-17)21-19(23)20-10-15-8-14-4-2-3-5-16(14)22-15/h2-9,12,22H,10-11H2,1H3,(H2,20,21,23) |
| InChIKey | WPBMOTBLJRMFHI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |