C21H20N2O4S2 — CID 60606007
2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 60606007) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60606007 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | C/C(=N/OCC(=O)N(Cc1cccs1)Cc1cccs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H20N2O4S2/c1-15(16-6-7-19-20(10-16)26-14-25-19)22-27-13-21(24)23(11-17-4-2-8-28-17)12-18-5-3-9-29-18/h2-10H,11-14H2,1H3/b22-15- |
| InChIKey | JPASFAQBPHYFGA-JCMHNJIXSA-N |
| XLogP | 4.51 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|