C21H19NO4S — CID 60606362
(2-phenylphenyl) 4-(propanoylamino)benzenesulfonate (PubChem CID 60606362) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is (2-phenylphenyl) 4-(propanoylamino)benzenesulfonate.
| Compound Name | (2-phenylphenyl) 4-(propanoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 60606362 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2-phenylphenyl) 4-(propanoylamino)benzenesulfonate |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)Oc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-2-21(23)22-17-12-14-18(15-13-17)27(24,25)26-20-11-7-6-10-19(20)16-8-4-3-5-9-16/h3-15H,2H2,1H3,(H,22,23) |
| InChIKey | JUAKTFDKASAFPF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|