C19H24N4O4 — CID 60614214
5-methyl-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 60614214) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 5-methyl-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 60614214 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5-methyl-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2cccc(COC3CCCC(C)C3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O4/c1-12-5-3-8-16(9-12)27-11-14-6-4-7-15(10-14)20-19(24)17-18(23(25)26)13(2)21-22-17/h4,6-7,10,12,16H,3,5,8-9,11H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | XTPQFSVIHGTVCD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|