C21H30N2O4 — CID 95252065
2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-[[(1R,3R)-3-methylcyclohexyl]oxymethyl]phenyl]-2-oxoacetamide (PubChem CID 95252065) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-[[(1R,3R)-3-methylcyclohexyl]oxymethyl]phenyl]-2-oxoacetamide.
| Compound Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-[[(1R,3R)-3-methylcyclohexyl]oxymethyl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 95252065 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-[[(1R,3R)-3-methylcyclohexyl]oxymethyl]phenyl]-2-oxoacetamide |
| SMILES | C[C@@H]1CCC[C@@H](OCc2cccc(NC(=O)C(=O)N3CCC[C@H](O)C3)c2)C1 |
| InChI | InChI=1S/C21H30N2O4/c1-15-5-2-9-19(11-15)27-14-16-6-3-7-17(12-16)22-20(25)21(26)23-10-4-8-18(24)13-23/h3,6-7,12,15,18-19,24H,2,4-5,8-11,13-14H2,1H3,(H,22,25)/t15-,18+,19-/m1/s1 |
| InChIKey | OUJJFEVIFUHBST-AYOQOUSVSA-N |
| XLogP | 2.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|