C26H34N2O4 — CID 86943907
N'-[1-(3-methoxyphenyl)propan-2-yl]-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]oxamide (PubChem CID 86943907) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N'-[1-(3-methoxyphenyl)propan-2-yl]-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]oxamide.
| Compound Name | N'-[1-(3-methoxyphenyl)propan-2-yl]-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]oxamide |
|---|---|
| PubChem CID | 86943907 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N'-[1-(3-methoxyphenyl)propan-2-yl]-N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]oxamide |
| SMILES | COc1cccc(CC(C)NC(=O)C(=O)Nc2cccc(COC3CCCC(C)C3)c2)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-18-7-4-12-24(13-18)32-17-21-9-5-10-22(15-21)28-26(30)25(29)27-19(2)14-20-8-6-11-23(16-20)31-3/h5-6,8-11,15-16,18-19,24H,4,7,12-14,17H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | DEXIBIZKLCPVOI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|