C23H29N3O3 — CID 86864516
N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-N'-(1-pyridin-4-ylethyl)oxamide (PubChem CID 86864516) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-N'-(1-pyridin-4-ylethyl)oxamide.
| Compound Name | N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-N'-(1-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 86864516 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[3-[(3-methylcyclohexyl)oxymethyl]phenyl]-N'-(1-pyridin-4-ylethyl)oxamide |
| SMILES | CC1CCCC(OCc2cccc(NC(=O)C(=O)NC(C)c3ccncc3)c2)C1 |
| InChI | InChI=1S/C23H29N3O3/c1-16-5-3-8-21(13-16)29-15-18-6-4-7-20(14-18)26-23(28)22(27)25-17(2)19-9-11-24-12-10-19/h4,6-7,9-12,14,16-17,21H,3,5,8,13,15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | BNUCEMOVVSEVGY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|