C18H19N3O3 — CID 60614369
1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-(2-hydroxyethyl)urea (PubChem CID 60614369) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 60614369 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H19N3O3/c22-11-9-19-18(24)20-15-6-3-5-14(12-15)17(23)21-10-8-13-4-1-2-7-16(13)21/h1-7,12,22H,8-11H2,(H2,19,20,24) |
| InChIKey | WLPNGQKZDRCGPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |