About 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea
1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 60614581) has the molecular formula C24H22FN3O3
and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
Molecular Properties
| Compound Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| PubChem CID | 60614581 |
| Molecular Formula | C24H22FN3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccccc1F)Nc1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C24H22FN3O3/c25-20-10-3-2-9-19(20)22(29)15-26-24(31)27-18-8-5-7-17(14-18)23(30)28-13-12-16-6-1-4-11-21(16)28/h1-11,14,22,29H,12-13,15H2,(H2,26,27,31) |
| InChIKey | ZZRLLXUFXDPANV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea?
The IUPAC name of 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (CID 60614581) is 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
What is the SMILES notation for 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea?
The canonical SMILES for 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea is O=C(NCC(O)c1ccccc1F)Nc1cccc(C(=O)N2CCc3ccccc32)c1.
What is the InChIKey of 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea?
The InChIKey is ZZRLLXUFXDPANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22FN3O3/c25-20-10-3-2-9-19(20)22(29)15-26-24(31)27-18-8-5-7-17(14-18)23(30)28-13-12-16-6-1-4-11-21(16)28/h1-11,14,22,29H,12-13,15H2,(H2,26,27,31).
What are the key properties of 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea?
1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea has a molecular weight of 419.46 g/mol, XLogP of 3.88, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,3-dihydroindole-1-carbonyl)phenyl]-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea is sourced from PubChem (CID 60614581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).