C20H30FN3O3 — CID 60614622
tert-butyl N-[[1-[3-(3-fluoroanilino)-3-oxopropyl]piperidin-3-yl]methyl]carbamate (PubChem CID 60614622) has the molecular formula C20H30FN3O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(3-fluoroanilino)-3-oxopropyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[3-(3-fluoroanilino)-3-oxopropyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 60614622 |
| Molecular Formula | C20H30FN3O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | tert-butyl N-[[1-[3-(3-fluoroanilino)-3-oxopropyl]piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(CCC(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H30FN3O3/c1-20(2,3)27-19(26)22-13-15-6-5-10-24(14-15)11-9-18(25)23-17-8-4-7-16(21)12-17/h4,7-8,12,15H,5-6,9-11,13-14H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | IZURNROXIYPCHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |