C18H24FN5O — CID 95249817
1-(3-fluorophenyl)-3-[[(3R)-1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]methyl]urea (PubChem CID 95249817) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[(3R)-1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[(3R)-1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95249817 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[(3R)-1-[(1-methylimidazol-2-yl)methyl]piperidin-3-yl]methyl]urea |
| SMILES | Cn1ccnc1CN1CCC[C@H](CNC(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H24FN5O/c1-23-9-7-20-17(23)13-24-8-3-4-14(12-24)11-21-18(25)22-16-6-2-5-15(19)10-16/h2,5-7,9-10,14H,3-4,8,11-13H2,1H3,(H2,21,22,25)/t14-/m1/s1 |
| InChIKey | MNNGKIYKUVKAEW-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |