C25H32FN3O3 — CID 71908791
1-(3-fluorophenyl)-3-[[1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperidin-3-yl]methyl]urea (PubChem CID 71908791) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperidin-3-yl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 71908791 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperidin-3-yl]methyl]urea |
| SMILES | O=C(NCC1CCCN(Cc2ccc(OCC3CCCO3)cc2)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C25H32FN3O3/c26-21-5-1-6-22(14-21)28-25(30)27-15-20-4-2-12-29(17-20)16-19-8-10-23(11-9-19)32-18-24-7-3-13-31-24/h1,5-6,8-11,14,20,24H,2-4,7,12-13,15-18H2,(H2,27,28,30) |
| InChIKey | BYCCIOMJJFAVHW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |