C20H28FN3O3 — CID 60614643
N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(oxolane-2-carbonyl)piperazine-1-carboxamide (PubChem CID 60614643) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(oxolane-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(oxolane-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60614643 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(oxolane-2-carbonyl)piperazine-1-carboxamide |
| SMILES | CC(C)(CNC(=O)N1CCN(C(=O)C2CCCO2)CC1)c1ccccc1F |
| InChI | InChI=1S/C20H28FN3O3/c1-20(2,15-6-3-4-7-16(15)21)14-22-19(26)24-11-9-23(10-12-24)18(25)17-8-5-13-27-17/h3-4,6-7,17H,5,8-14H2,1-2H3,(H,22,26) |
| InChIKey | FPSBAUGMZWWBEI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |