C19H16BrFN4O2 — CID 60614966
N-[2-[(3-bromobenzoyl)amino]ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide (PubChem CID 60614966) has the molecular formula C19H16BrFN4O2 and a molecular weight of 431.27 g/mol. Its IUPAC name is N-[2-[(3-bromobenzoyl)amino]ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 60614966 |
| Molecular Formula | C19H16BrFN4O2 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-1-(2-fluorophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccn(-c2ccccc2F)n1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H16BrFN4O2/c20-14-5-3-4-13(12-14)18(26)22-9-10-23-19(27)16-8-11-25(24-16)17-7-2-1-6-15(17)21/h1-8,11-12H,9-10H2,(H,22,26)(H,23,27) |
| InChIKey | QPYFQZCKDQTGRG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|