C23H35BrN2O3S — CID 60621681
N-[1-[(4-bromophenyl)methyl]cyclohexyl]-1-butylsulfonylpiperidine-4-carboxamide (PubChem CID 60621681) has the molecular formula C23H35BrN2O3S and a molecular weight of 499.52 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)methyl]cyclohexyl]-1-butylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-[(4-bromophenyl)methyl]cyclohexyl]-1-butylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60621681 |
| Molecular Formula | C23H35BrN2O3S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[1-[(4-bromophenyl)methyl]cyclohexyl]-1-butylsulfonylpiperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NC2(Cc3ccc(Br)cc3)CCCCC2)CC1 |
| InChI | InChI=1S/C23H35BrN2O3S/c1-2-3-17-30(28,29)26-15-11-20(12-16-26)22(27)25-23(13-5-4-6-14-23)18-19-7-9-21(24)10-8-19/h7-10,20H,2-6,11-18H2,1H3,(H,25,27) |
| InChIKey | SSNIOXPOKXETTM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |