C7H13N3OS — CID 60626166
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol (PubChem CID 60626166) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol.
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 60626166 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
| SMILES | Cc1nnc(SCCCO)n1C |
| InChI | InChI=1S/C7H13N3OS/c1-6-8-9-7(10(6)2)12-5-3-4-11/h11H,3-5H2,1-2H3 |
| InChIKey | ONESBNXTZMYBRH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|