About 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol (PubChem CID 60626166) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
| PubChem CID | 60626166 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol |
| SMILES | Cc1nnc(SCCCO)n1C |
| InChI | InChI=1S/C7H13N3OS/c1-6-8-9-7(10(6)2)12-5-3-4-11/h11H,3-5H2,1-2H3 |
| InChIKey | ONESBNXTZMYBRH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol?
The IUPAC name of 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol (CID 60626166) is 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol.
What is the SMILES notation for 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol?
The canonical SMILES for 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol is Cc1nnc(SCCCO)n1C.
What is the InChIKey of 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol?
The InChIKey is ONESBNXTZMYBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-6-8-9-7(10(6)2)12-5-3-4-11/h11H,3-5H2,1-2H3.
What are the key properties of 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol?
3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol has a molecular weight of 187.27 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-ol is sourced from PubChem (CID 60626166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).