C30H21N3O3S2 — CID 6064245
(7E)-7-(1,3-benzodioxol-5-ylmethylidene)-2,4,9-triphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one (PubChem CID 6064245) has the molecular formula C30H21N3O3S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is (7E)-7-(1,3-benzodioxol-5-ylmethylidene)-2,4,9-triphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one.
| Compound Name | (7E)-7-(1,3-benzodioxol-5-ylmethylidene)-2,4,9-triphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
|---|---|
| PubChem CID | 6064245 |
| Molecular Formula | C30H21N3O3S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (7E)-7-(1,3-benzodioxol-5-ylmethylidene)-2,4,9-triphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCO3)SC2(SC(c3ccccc3)=NN2c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C30H21N3O3S2/c34-29-27(19-21-16-17-25-26(18-21)36-20-35-25)37-30(32(29)23-12-6-2-7-13-23)33(24-14-8-3-9-15-24)31-28(38-30)22-10-4-1-5-11-22/h1-19H,20H2/b27-19+ |
| InChIKey | DMDWVTPKYVMRCJ-ZXVVBBHZSA-N |
| XLogP | 6.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|