C16H30N2 — CID 606460
7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecane (PubChem CID 606460) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecane.
| Compound Name | 7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 606460 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCCCCC1CC2CCCCN2C2CCCN12 |
| InChI | InChI=1S/C16H30N2/c1-2-3-4-8-14-13-15-9-5-6-11-17(15)16-10-7-12-18(14)16/h14-16H,2-13H2,1H3 |
| InChIKey | LZWJLKSLNYSQFC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|