C15H28N2 — CID 616600
7-butyl-1,6-diazatricyclo[7.4.0.02,6]tridecane (PubChem CID 616600) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 7-butyl-1,6-diazatricyclo[7.4.0.02,6]tridecane.
| Compound Name | 7-butyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 616600 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 7-butyl-1,6-diazatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCCCC1CC2CCCCN2C2CCCN12 |
| InChI | InChI=1S/C15H28N2/c1-2-3-7-13-12-14-8-4-5-10-16(14)15-9-6-11-17(13)15/h13-15H,2-12H2,1H3 |
| InChIKey | IZTRCXOGWXUQHC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |