C15H23NO4 — CID 60653323
N,N-bis(2-hydroxyethyl)-4-(3-methylphenoxy)butanamide (PubChem CID 60653323) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-(3-methylphenoxy)butanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 60653323 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-(3-methylphenoxy)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C15H23NO4/c1-13-4-2-5-14(12-13)20-11-3-6-15(19)16(7-9-17)8-10-18/h2,4-5,12,17-18H,3,6-11H2,1H3 |
| InChIKey | ODMWQILLIKPMQU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|