C16H22F3NO2 — CID 86841292
N-methyl-5-(3-methylphenoxy)-N-(3,3,3-trifluoropropyl)pentanamide (PubChem CID 86841292) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-methyl-5-(3-methylphenoxy)-N-(3,3,3-trifluoropropyl)pentanamide.
| Compound Name | N-methyl-5-(3-methylphenoxy)-N-(3,3,3-trifluoropropyl)pentanamide |
|---|---|
| PubChem CID | 86841292 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-methyl-5-(3-methylphenoxy)-N-(3,3,3-trifluoropropyl)pentanamide |
| SMILES | Cc1cccc(OCCCCC(=O)N(C)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3NO2/c1-13-6-5-7-14(12-13)22-11-4-3-8-15(21)20(2)10-9-16(17,18)19/h5-7,12H,3-4,8-11H2,1-2H3 |
| InChIKey | JTTQXRRVCBBCCN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|