C29H27N3O3 — CID 6066392
(5Z)-3-ethyl-5-(1-ethyl-6-methylquinolin-2-ylidene)-2-(4-phenoxyphenyl)imino-1,3-oxazolidin-4-one (PubChem CID 6066392) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-(1-ethyl-6-methylquinolin-2-ylidene)-2-(4-phenoxyphenyl)imino-1,3-oxazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-5-(1-ethyl-6-methylquinolin-2-ylidene)-2-(4-phenoxyphenyl)imino-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 6066392 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (5Z)-3-ethyl-5-(1-ethyl-6-methylquinolin-2-ylidene)-2-(4-phenoxyphenyl)imino-1,3-oxazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C2\C=Cc3cc(C)ccc3N2CC)O/C1=N/c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N3O3/c1-4-31-25-17-11-20(3)19-21(25)12-18-26(31)27-28(33)32(5-2)29(35-27)30-22-13-15-24(16-14-22)34-23-9-7-6-8-10-23/h6-19H,4-5H2,1-3H3/b27-26-,30-29+ |
| InChIKey | ZRKNCTMHTFQEEG-YLIMEJQESA-N |
| XLogP | 6.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_J(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|