C15H14N2O — CID 60685428
N-[(5-methyl-1,2-oxazol-3-yl)methyl]naphthalen-2-amine (PubChem CID 60685428) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(5-methyl-1,2-oxazol-3-yl)methyl]naphthalen-2-amine.
| Compound Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 60685428 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]naphthalen-2-amine |
| SMILES | Cc1cc(CNc2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C15H14N2O/c1-11-8-15(17-18-11)10-16-14-7-6-12-4-2-3-5-13(12)9-14/h2-9,16H,10H2,1H3 |
| InChIKey | PXLADISVHVQVSI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |