C11H22N2O2 — CID 60687539
1-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)ethanone (PubChem CID 60687539) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)ethanone.
| Compound Name | 1-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)ethanone |
|---|---|
| PubChem CID | 60687539 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)ethanone |
| SMILES | CCCNCC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-12-6-11(14)13-7-9(2)15-10(3)8-13/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | XMCKYXPUMPKDRN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|