C25H25F3N2O4 — CID 6069005
[2-(benzhydrylamino)-2-oxoethyl] 1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]piperidine-4-carboxylate (PubChem CID 6069005) has the molecular formula C25H25F3N2O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]piperidine-4-carboxylate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6069005 |
| Molecular Formula | C25H25F3N2O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(/C=C/C(=O)C(F)(F)F)CC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25F3N2O4/c26-25(27,28)21(31)13-16-30-14-11-20(12-15-30)24(33)34-17-22(32)29-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,13,16,20,23H,11-12,14-15,17H2,(H,29,32)/b16-13+ |
| InChIKey | WVPNVUXOUZMOKO-DTQAZKPQSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|