C14H21Cl2N3 — CID 60701467
N-[(2,4-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 60701467) has the molecular formula C14H21Cl2N3 and a molecular weight of 302.25 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 60701467 |
| Molecular Formula | C14H21Cl2N3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CN1CCN(CCNCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H21Cl2N3/c1-18-6-8-19(9-7-18)5-4-17-11-12-2-3-13(15)10-14(12)16/h2-3,10,17H,4-9,11H2,1H3 |
| InChIKey | HCMQPSGGEOSSBA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|