C14H14N2O3S — CID 60704601
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-(1H-indol-3-yl)acetamide (PubChem CID 60704601) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 60704601 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14N2O3S/c17-14(16-11-5-6-20(18,19)9-11)7-10-8-15-13-4-2-1-3-12(10)13/h1-6,8,11,15H,7,9H2,(H,16,17) |
| InChIKey | XBJTVOANSFYVRJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |