C10H14N2O4 — CID 60734743
propan-2-yl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 60734743) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is propan-2-yl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | propan-2-yl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 60734743 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | propan-2-yl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | Cc1cn(CC(=O)OC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-6(2)16-8(13)5-12-4-7(3)9(14)11-10(12)15/h4,6H,5H2,1-3H3,(H,11,14,15) |
| InChIKey | FOOUIEFOSLQTRH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |