C8H9IN2O4 — CID 745125
ethyl 2-(5-iodo-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 745125) has the molecular formula C8H9IN2O4 and a molecular weight of 324.07 g/mol. Its IUPAC name is ethyl 2-(5-iodo-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | ethyl 2-(5-iodo-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 745125 |
| Molecular Formula | C8H9IN2O4 |
| Molecular Weight | 324.07 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | ethyl 2-(5-iodo-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9IN2O4/c1-2-15-6(12)4-11-3-5(9)7(13)10-8(11)14/h3H,2,4H2,1H3,(H,10,13,14) |
| InChIKey | QHZFWCFMBJICGX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.07 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|